CAS 21325-43-9 is the registry number for 1-Bromo-3-nitro-2-thiocyanatobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-bromo-6-nitrophenyl) thiocyanate (CAS 21325-43-9) is a chemical compound with the molecular formula C7H3BrN2O2S and a molecular weight of 259.08 g/mol. IUPAC name: (2-bromo-6-nitrophenyl) thiocyanate. InChIKey: VHDLRAITWWCIHH-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2S |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | (2-bromo-6-nitrophenyl) thiocyanate |
| InChIKey | VHDLRAITWWCIHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)SC#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)