CAS 196205-22-8 is the registry number for 7-Bromo-5-nitrobenzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-nitro-1,3-benzothiazole (CAS 196205-22-8) is a chemical compound with the molecular formula C7H3BrN2O2S and a molecular weight of 259.08 g/mol. IUPAC name: 7-bromo-5-nitro-1,3-benzothiazole. InChIKey: FHIUHLVAUJKHNJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O2S |
|---|---|
| Molecular weight | 259.08 g/mol |
| IUPAC name | 7-bromo-5-nitro-1,3-benzothiazole |
| InChIKey | FHIUHLVAUJKHNJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CS2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)