Products 1780217-49-3

CAS 1780217-49-3 is the registry number for 5-Hydroxy-4-methylnicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-hydroxy-4-methylpyridine-3-carboxylic acid (CAS 1780217-49-3) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 5-hydroxy-4-methylpyridine-3-carboxylic acid. InChIKey: XXJQESGVXUPIAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO3
Molecular weight153.14 g/mol
IUPAC name5-hydroxy-4-methylpyridine-3-carboxylic acid
InChIKeyXXJQESGVXUPIAZ-UHFFFAOYSA-N
SMILESCC1=C(C=NC=C1C(=O)O)O

Computed by PubChem (NCBI)