Products 1780541-60-7
CAS 1780541-60-7 is the registry number for (2-Amino-4-chlorophenyl)(tetrahydro-2-furanyl)-methanone. Offered by: TRC. Available pack sizes: 1g.
(2-amino-4-chlorophenyl)-(oxolan-2-yl)methanone (CAS 1780541-60-7) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: (2-amino-4-chlorophenyl)-(oxolan-2-yl)methanone. InChIKey: RHPCOTARDDTVHM-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | (2-amino-4-chlorophenyl)-(oxolan-2-yl)methanone |
| InChIKey | RHPCOTARDDTVHM-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C(=O)C2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)