CAS 17809-36-8 appears in our catalog under these names: 2-Fluoro-6-nitroaniline 97%, 2-Fluoro-6-nitroaniline, 97%, 97%, 2-Fluoro-6-nitroaniline, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
2-fluoro-6-nitroaniline (CAS 17809-36-8) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-6-nitroaniline. InChIKey: BHWHYGWMNMCXBA-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-6-nitroaniline |
| InChIKey | BHWHYGWMNMCXBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)