CAS 1780907-91-6 is the registry number for 5-Chloro-1,4-dihydro-2H-benzo(d)(1,3)oxazin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-1,4-dihydro-3,1-benzoxazin-2-one (CAS 1780907-91-6) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 5-chloro-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: QZDYSMPUCMWXSR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 5-chloro-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | QZDYSMPUCMWXSR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Cl)NC(=O)O1 |
Computed by PubChem (NCBI)