CAS 1780994-55-9 appears in our catalog under these names: 3-({((tert-Butoxy)carbonyl)amino}methyl)-4-fluorobenzoic acid, 3-({[(tert-butoxy)carbonyl]amino}methyl)-4-fluorobenzoic acid, ≥95%, ≥95%, 3-(((tert-Butoxycarbonyl)amino)methyl)-4-fluorobenzoic acid, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
4-fluoro-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid (CAS 1780994-55-9) is a chemical compound with the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. IUPAC name: 4-fluoro-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid. InChIKey: DLJGSCFWYUWGNJ-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO4 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 4-fluoro-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid |
| InChIKey | DLJGSCFWYUWGNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)