CAS 1781190-36-0 is the registry number for 5-Cyclopropyl-1,4-dimethyl-1H-pyrazole-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid (CAS 1781190-36-0) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid. InChIKey: USKBEJXRNQVMHT-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 5-cyclopropyl-1,4-dimethylpyrazole-3-carboxylic acid |
| InChIKey | USKBEJXRNQVMHT-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C(=O)O)C)C2CC2 |
Computed by PubChem (NCBI)