CAS 1781628-74-7 is the registry number for Methyl-13C, d3 Toluenesulfonate. Offered by: TRC. Available pack sizes: 250mg.
Trideuterio(113C)methyl 4-methylbenzenesulfonate (CAS 1781628-74-7) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 190.24 g/mol. IUPAC name: trideuterio(113C)methyl 4-methylbenzenesulfonate. InChIKey: VUQUOGPMUUJORT-JVXUGDAPSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trideuterio(113C)methyl 4-methylbenzenesulfonate |
| InChIKey | VUQUOGPMUUJORT-JVXUGDAPSA-N |
| SMILES | [2H][13C]([2H])([2H])OS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)