Products 1781628-74-7

CAS 1781628-74-7 is the registry number for Methyl-13C, d3 Toluenesulfonate. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Trideuterio(113C)methyl 4-methylbenzenesulfonate (CAS 1781628-74-7) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 190.24 g/mol. IUPAC name: trideuterio(113C)methyl 4-methylbenzenesulfonate. InChIKey: VUQUOGPMUUJORT-JVXUGDAPSA-N.

Identity
Molecular formulaC8H10O3S
Molecular weight190.24 g/mol
IUPAC nametrideuterio(113C)methyl 4-methylbenzenesulfonate
InChIKeyVUQUOGPMUUJORT-JVXUGDAPSA-N
SMILES[2H][13C]([2H])([2H])OS(=O)(=O)C1=CC=C(C=C1)C

Computed by PubChem (NCBI)