CAS 7575-93-1 appears in our catalog under these names: Methyl-d3 p-toluenesulfonate, 98%, Methyl-d3 Toluenesulfonate, >95% (HPLC), Methyl-d3 p-Toluenesulfonate, 99 atom % D, min 98% Chemical Purity, Methy–d3 (toluenesulfonate), Methy-d3 (toluenesulfonate), 99.81%. Offered by: Combi-blocks, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 50mg, 0,5g, 100mg, 25mg, 25 mg.
Trideuteriomethyl 4-methylbenzenesulfonate (CAS 7575-93-1) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 189.25 g/mol. IUPAC name: trideuteriomethyl 4-methylbenzenesulfonate. InChIKey: VUQUOGPMUUJORT-BMSJAHLVSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | trideuteriomethyl 4-methylbenzenesulfonate |
| InChIKey | VUQUOGPMUUJORT-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)