CAS 80-48-8 appears in our catalog under these names: p-Toluenesulfonic Acid Impurity 2 (Methyl p-Toluenesulfonate), Methyl p-toluenesulfonate, Methyl p-Toluenesulfonate, >95% (HPLC), Methyl Toluene-4-sulphonate, Methyl–p–toluenesulfonate. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 100g, 25g, 5g, 100mg, 500g, 1000g, 250g.
Methyl 4-methylbenzenesulfonate (CAS 80-48-8) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: methyl 4-methylbenzenesulfonate. InChIKey: VUQUOGPMUUJORT-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | methyl 4-methylbenzenesulfonate |
| InChIKey | VUQUOGPMUUJORT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC |
Computed by PubChem (NCBI)