Products 1781757-38-7

CAS 1781757-38-7 is the registry number for 5-Methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid (CAS 1781757-38-7) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 5-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid. InChIKey: PRFJXUDMSWZQOF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O2
Molecular weight192.21 g/mol
IUPAC name5-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid
InChIKeyPRFJXUDMSWZQOF-UHFFFAOYSA-N
SMILESCC1=NC=CC2=C1C(CNC2)C(=O)O

Computed by PubChem (NCBI)