Products 1781824-30-3

CAS 1781824-30-3 is the registry number for 2-(3-{[(tert-butoxy)carbonyl]amino}cyclopentyl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid (CAS 1781824-30-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid. InChIKey: LDBFBCYPFDOYEV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO4
Molecular weight243.30 g/mol
IUPAC name2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid
InChIKeyLDBFBCYPFDOYEV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC(C1)CC(=O)O

Computed by PubChem (NCBI)