CAS 884006-81-9 is the registry number for 2-(trans-3-((tert-Butoxycarbonyl)amino)cyclopentyl)acetic Acid. Offered by: TRC. Available pack sizes: 1g.
2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid (CAS 884006-81-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid. InChIKey: LDBFBCYPFDOYEV-DTWKUNHWSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]acetic acid |
| InChIKey | LDBFBCYPFDOYEV-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)CC(=O)O |
Computed by PubChem (NCBI)