CAS 1781922-43-7 is the registry number for 7-Methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid (CAS 1781922-43-7) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 7-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid. InChIKey: SRMVXCLXNBQUFO-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 7-methyl-1,2,3,4-tetrahydro-2,6-naphthyridine-4-carboxylic acid |
| InChIKey | SRMVXCLXNBQUFO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=N1)C(CNC2)C(=O)O |
Computed by PubChem (NCBI)