CAS 1782143-94-5 appears in our catalog under these names: Morinidazole Impurity 5, Morinidazole Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-methyl-5-nitroimidazol-1-yl)-2-morpholin-4-ylpropan-1-ol (CAS 1782143-94-5) is a chemical compound with the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. IUPAC name: 3-(2-methyl-5-nitroimidazol-1-yl)-2-morpholin-4-ylpropan-1-ol. InChIKey: WHESGZOXASJSGL-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O4 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | 3-(2-methyl-5-nitroimidazol-1-yl)-2-morpholin-4-ylpropan-1-ol |
| InChIKey | WHESGZOXASJSGL-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CC(CO)N2CCOCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)