CAS 898230-56-3 is the registry number for S-Morinidazole, Ornidazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(2-methyl-5-nitroimidazol-1-yl)-3-morpholin-4-ylpropan-2-ol (CAS 898230-56-3) is a chemical compound with the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. IUPAC name: (2S)-1-(2-methyl-5-nitroimidazol-1-yl)-3-morpholin-4-ylpropan-2-ol. InChIKey: GAZGHCHCYRSPIV-JTQLQIEISA-N.
| Molecular formula | C11H18N4O4 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | (2S)-1-(2-methyl-5-nitroimidazol-1-yl)-3-morpholin-4-ylpropan-2-ol |
| InChIKey | GAZGHCHCYRSPIV-JTQLQIEISA-N |
| SMILES | CC1=NC=C(N1C[C@H](CN2CCOCC2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)