Products 227600-03-5
CAS 227600-03-5 appears in our catalog under these names: Oseltamivir Impurity 95, Oseltamivir Impurity 108. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,4R,5S)-4-amino-5-azido-3-(methoxymethoxy)cyclohexene-1-carboxylate (CAS 227600-03-5) is a chemical compound with the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-amino-5-azido-3-(methoxymethoxy)cyclohexene-1-carboxylate. InChIKey: MRUQSBLHRTUCQB-IVZWLZJFSA-N.
| Molecular formula | C11H18N4O4 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-amino-5-azido-3-(methoxymethoxy)cyclohexene-1-carboxylate |
| InChIKey | MRUQSBLHRTUCQB-IVZWLZJFSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@@H]([C@H](C1)N=[N+]=[N-])N)OCOC |
Computed by PubChem (NCBI)