CAS 84520-68-3 appears in our catalog under these names: Boc-L-cis-4-azidoproline Methyl Ester, (2S,4S)-1-tert-Butyl 2-methyl 4-azidopyrrolidine-1,2-dicarboxylate 95%. Offered by: TRC, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g.
1-O-tert-butyl 2-O-methyl (2S,4S)-4-azidopyrrolidine-1,2-dicarboxylate (CAS 84520-68-3) is a chemical compound with the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-azidopyrrolidine-1,2-dicarboxylate. InChIKey: BJQMWOSPZUZYNW-YUMQZZPRSA-N.
| Molecular formula | C11H18N4O4 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-azidopyrrolidine-1,2-dicarboxylate |
| InChIKey | BJQMWOSPZUZYNW-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)N=[N+]=[N-] |
Computed by PubChem (NCBI)