CAS 1782285-05-5 appears in our catalog under these names: Eltrombopag Impurity 45, Eltrombopag Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dimethylphenyl)-3-methyl-1H-pyrazol-5-one (CAS 1782285-05-5) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)-3-methyl-1H-pyrazol-5-one. InChIKey: CDQWCFNQOYHCNN-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)-3-methyl-1H-pyrazol-5-one |
| InChIKey | CDQWCFNQOYHCNN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=CC(=O)N2)C)C |
Computed by PubChem (NCBI)