Products 1782292-37-8
CAS 1782292-37-8 is the registry number for 1-[(tert-butoxy)carbonyl]-1H-pyrrole-3-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg.
1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrole-3-carboxylic acid (CAS 1782292-37-8) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrole-3-carboxylic acid. InChIKey: REFCYMTXUSPOOM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrole-3-carboxylic acid |
| InChIKey | REFCYMTXUSPOOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)