Products 1782489-29-5
CAS 1782489-29-5 is the registry number for 4-(3-Bromophenyl)-1-(methylsulfonyl)piperidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-bromophenyl)-1-methylsulfonylpiperidine (CAS 1782489-29-5) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: 4-(3-bromophenyl)-1-methylsulfonylpiperidine. InChIKey: ITZCIQMAMQFPLT-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | 4-(3-bromophenyl)-1-methylsulfonylpiperidine |
| InChIKey | ITZCIQMAMQFPLT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)