CAS 1782758-66-0 is the registry number for 5-Bromo-3-ethyl-2-methoxybenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-bromo-3-ethyl-2-methoxybenzaldehyde (CAS 1782758-66-0) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 5-bromo-3-ethyl-2-methoxybenzaldehyde. InChIKey: YATSCGVJCYLBTH-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 5-bromo-3-ethyl-2-methoxybenzaldehyde |
| InChIKey | YATSCGVJCYLBTH-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC(=C1)Br)C=O)OC |
Computed by PubChem (NCBI)