CAS 17831-01-5 is the registry number for Benzyl L-alaninate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-2-aminopropanoate (CAS 17831-01-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: benzyl (2S)-2-aminopropanoate. InChIKey: YGYLYUIRSJSFJS-QMMMGPOBSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | benzyl (2S)-2-aminopropanoate |
| InChIKey | YGYLYUIRSJSFJS-QMMMGPOBSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)