Products 1783596-00-8

CAS 1783596-00-8 is the registry number for 3-(4,5-Dimethoxy-2-methylphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4,5-dimethoxy-2-methylphenyl)-2-hydroxypropanoic acid (CAS 1783596-00-8) is a chemical compound with the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(4,5-dimethoxy-2-methylphenyl)-2-hydroxypropanoic acid. InChIKey: IOZGBAAUDXTKSD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O5
Molecular weight240.25 g/mol
IUPAC name3-(4,5-dimethoxy-2-methylphenyl)-2-hydroxypropanoic acid
InChIKeyIOZGBAAUDXTKSD-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1CC(C(=O)O)O)OC)OC

Computed by PubChem (NCBI)