CAS 1783619-00-0 appears in our catalog under these names: 7–Fluoro–1H–indazole–4–carboxylic acid, 7-Fluoro-1H-indazole-4-carboxylic acid, 7-Fluoro-1H-indazole-4-carboxylic acid, 97%, 97%, 7-Fluoro-1H-indazole-4-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g, 500mg.
7-fluoro-1H-indazole-4-carboxylic acid (CAS 1783619-00-0) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 7-fluoro-1H-indazole-4-carboxylic acid. InChIKey: RVKGZISUCCZWIP-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 7-fluoro-1H-indazole-4-carboxylic acid |
| InChIKey | RVKGZISUCCZWIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1C(=O)O)C=NN2)F |
Computed by PubChem (NCBI)