CAS 1783624-20-3 appears in our catalog under these names: 7-(Difluoromethyl)-1,2,3,4-tetrahydroquinoline, 95%, 7-(Difluoromethyl)-1,2,3,4-tetrahydroquinoline, 7–(Difluoromethyl)–1,2,3,4–tetrahydroquinoline, Quinoline, 7-(difluoromethyl)-1,2,3,4-tetrahydro-, 98%, 98%, 7-(DIFLUOROMETHYL)-1,2,3,4-TETRAHYDROQUINOLINE, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 2g, 10g, 25g, 50g.
7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1783624-20-3) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: 7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: PGOLXTGHMFUFNX-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 7-(difluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | PGOLXTGHMFUFNX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C(F)F)NC1 |
Computed by PubChem (NCBI)