CAS 1784-70-9 appears in our catalog under these names: 1,3-Dimethyl-8-thioxo-3,7,8,9-tetrahydro-1H-purine-2,6-dione, 98%, 1,3-Dimethyl-8-sulfanyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 2,5g.
1,3-dimethyl-8-sulfanylidene-7,9-dihydropurine-2,6-dione (CAS 1784-70-9) is a chemical compound with the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. IUPAC name: 1,3-dimethyl-8-sulfanylidene-7,9-dihydropurine-2,6-dione. InChIKey: NBQIXPZKEFZVMP-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 1,3-dimethyl-8-sulfanylidene-7,9-dihydropurine-2,6-dione |
| InChIKey | NBQIXPZKEFZVMP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=S)N2 |
Computed by PubChem (NCBI)