CAS 1955557-78-4 is the registry number for 1-Methyl-1H-1,2,3-benzotriazole-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methylbenzotriazole-5-sulfonamide (CAS 1955557-78-4) is a chemical compound with the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. IUPAC name: 1-methylbenzotriazole-5-sulfonamide. InChIKey: PDETZGLFWGCAPF-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 1-methylbenzotriazole-5-sulfonamide |
| InChIKey | PDETZGLFWGCAPF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)N)N=N1 |
Computed by PubChem (NCBI)