CAS 73305-12-1 appears in our catalog under these names: N-(2-Nitrophenyl)hydrazinecarbothioamide, 95+%, 4-(2-Nitrophenyl)-3-thiosemicarbazide. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg.
1-amino-3-(2-nitrophenyl)thiourea (CAS 73305-12-1) is a chemical compound with the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. IUPAC name: 1-amino-3-(2-nitrophenyl)thiourea. InChIKey: SCSGXHUQNKDYPY-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 1-amino-3-(2-nitrophenyl)thiourea |
| InChIKey | SCSGXHUQNKDYPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=S)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)