CAS 1797073-53-0 appears in our catalog under these names: 1-Methyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonamide, 95%, 1-Methyl-1H-pyrazolo(3,4-b)pyridine-5-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-methylpyrazolo[3,4-b]pyridine-5-sulfonamide (CAS 1797073-53-0) is a chemical compound with the molecular formula C7H8N4O2S and a molecular weight of 212.23 g/mol. IUPAC name: 1-methylpyrazolo[3,4-b]pyridine-5-sulfonamide. InChIKey: KQQRJZILXTYCMC-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2S |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 1-methylpyrazolo[3,4-b]pyridine-5-sulfonamide |
| InChIKey | KQQRJZILXTYCMC-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=C(C=C2C=N1)S(=O)(=O)N |
Computed by PubChem (NCBI)