CAS 1784297-35-3 appears in our catalog under these names: 2-(3-Methoxyisoxazol-5-yl)-3-methylbutanoic acid, 98%, 2-(3-Methoxyisoxazol-5-yl)-3-methylbutanoic acid, 95%, 95%, 2-(3-methoxyisoxazol-5-yl)-3-methyl-butanoic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-(3-methoxy-1,2-oxazol-5-yl)-3-methylbutanoic acid (CAS 1784297-35-3) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: 2-(3-methoxy-1,2-oxazol-5-yl)-3-methylbutanoic acid. InChIKey: QQLDRQAFIXCVFD-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-(3-methoxy-1,2-oxazol-5-yl)-3-methylbutanoic acid |
| InChIKey | QQLDRQAFIXCVFD-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=NO1)OC)C(=O)O |
Computed by PubChem (NCBI)