CAS 1784313-67-2 appears in our catalog under these names: 5-Bromo-7-chloro-1,2,3,4-tetrahydroquinoline, 95%, 5-Bromo-7-chloro-1,2,3,4-tetrahydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-7-chloro-1,2,3,4-tetrahydroquinoline (CAS 1784313-67-2) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 5-bromo-7-chloro-1,2,3,4-tetrahydroquinoline. InChIKey: IBLOHCCTDNVSTM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 5-bromo-7-chloro-1,2,3,4-tetrahydroquinoline |
| InChIKey | IBLOHCCTDNVSTM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2Br)Cl)NC1 |
Computed by PubChem (NCBI)