Products 1784326-15-3
CAS 1784326-15-3 is the registry number for 6-bromoimidazo[1,2-a]pyridine-5-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromoimidazo[1,2-a]pyridine-5-carboxylic acid (CAS 1784326-15-3) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromoimidazo[1,2-a]pyridine-5-carboxylic acid. InChIKey: IMHKDFLUFQDIHL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromoimidazo[1,2-a]pyridine-5-carboxylic acid |
| InChIKey | IMHKDFLUFQDIHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C(=C1Br)C(=O)O |
Computed by PubChem (NCBI)