Products 1784331-75-4
CAS 1784331-75-4 is the registry number for 2-Bromo-7-fluoro-1H-indole-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-7-fluoro-1H-indole-3-carboxylic acid (CAS 1784331-75-4) is a chemical compound with the molecular formula C9H5BrFNO2 and a molecular weight of 258.04 g/mol. IUPAC name: 2-bromo-7-fluoro-1H-indole-3-carboxylic acid. InChIKey: MMLLSDWWQSGMSY-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO2 |
|---|---|
| Molecular weight | 258.04 g/mol |
| IUPAC name | 2-bromo-7-fluoro-1H-indole-3-carboxylic acid |
| InChIKey | MMLLSDWWQSGMSY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC(=C2C(=O)O)Br |
Computed by PubChem (NCBI)