CAS 1784551-71-8 is the registry number for 1,6-Dichloroisoquinoline-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,6-dichloroisoquinoline-4-carbonitrile (CAS 1784551-71-8) is a chemical compound with the molecular formula C10H4Cl2N2 and a molecular weight of 223.05 g/mol. IUPAC name: 1,6-dichloroisoquinoline-4-carbonitrile. InChIKey: HIBVTRSRPJQOCU-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 1,6-dichloroisoquinoline-4-carbonitrile |
| InChIKey | HIBVTRSRPJQOCU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN=C2Cl)C#N |
Computed by PubChem (NCBI)