CAS 948291-61-0 appears in our catalog under these names: 2,6-Dichloroquinoline-3-carbonitrile, 95%, 2,6-Dichloroquinoline-3-carbonitrile, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,6-dichloroquinoline-3-carbonitrile (CAS 948291-61-0) is a chemical compound with the molecular formula C10H4Cl2N2 and a molecular weight of 223.05 g/mol. IUPAC name: 2,6-dichloroquinoline-3-carbonitrile. InChIKey: VITYMWFVJDUOBD-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2,6-dichloroquinoline-3-carbonitrile |
| InChIKey | VITYMWFVJDUOBD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1Cl)C#N)Cl |
Computed by PubChem (NCBI)