CAS 2972-76-1 is the registry number for 2-[(2,4-Dichlorophenyl)methylidene]propanedinitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(2,4-dichlorophenyl)methylidene]propanedinitrile (CAS 2972-76-1) is a chemical compound with the molecular formula C10H4Cl2N2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-[(2,4-dichlorophenyl)methylidene]propanedinitrile. InChIKey: RRVZSQGJZJMCAE-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-[(2,4-dichlorophenyl)methylidene]propanedinitrile |
| InChIKey | RRVZSQGJZJMCAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C=C(C#N)C#N |
Computed by PubChem (NCBI)