CAS 936498-04-3 appears in our catalog under these names: 4,6-dichloroquinoline-3-carbonitrile, 98+%, 4,6-dichloro-quinoline-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg.
4,6-dichloroquinoline-3-carbonitrile (CAS 936498-04-3) is a chemical compound with the molecular formula C10H4Cl2N2 and a molecular weight of 223.05 g/mol. IUPAC name: 4,6-dichloroquinoline-3-carbonitrile. InChIKey: JTWDDTWMLBDQNM-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 4,6-dichloroquinoline-3-carbonitrile |
| InChIKey | JTWDDTWMLBDQNM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Cl)Cl)C#N |
Computed by PubChem (NCBI)