CAS 17847-51-7 is the registry number for 3,4-dichlorophenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3,4-dichlorophenyl) acetate (CAS 17847-51-7) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: (3,4-dichlorophenyl) acetate. InChIKey: OSKGYRIYNMZFSJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | (3,4-dichlorophenyl) acetate |
| InChIKey | OSKGYRIYNMZFSJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)