CAS 2875066-95-6 is the registry number for (4S,5R)-4,5-Dimethyl-5-(trifluoromethyl)dihydrofuran-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5R)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one (CAS 2875066-95-6) is a chemical compound with the molecular formula C7H9F3O2 and a molecular weight of 182.14 g/mol. IUPAC name: (4S,5R)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one. InChIKey: WVYZIKDOMNTJGP-UJURSFKZSA-N.
| Molecular formula | C7H9F3O2 |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | (4S,5R)-4,5-dimethyl-5-(trifluoromethyl)oxolan-2-one |
| InChIKey | WVYZIKDOMNTJGP-UJURSFKZSA-N |
| SMILES | C[C@H]1CC(=O)O[C@@]1(C)C(F)(F)F |
Computed by PubChem (NCBI)