Products 1785-67-7
CAS 1785-67-7 is the registry number for Naphthalene-1,2,4-triyl triacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-diacetyloxynaphthalen-1-yl) acetate (CAS 1785-67-7) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: (3,4-diacetyloxynaphthalen-1-yl) acetate. InChIKey: QJECYGRWVGWSQT-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | (3,4-diacetyloxynaphthalen-1-yl) acetate |
| InChIKey | QJECYGRWVGWSQT-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=C(C2=CC=CC=C21)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Naphthalene-1,2,4-triyl triacetate, (3,4-diacetyloxynaphthalen-1-yl) acetate, 1,2,4-Naphthalenetriol, 1,2,4-triacetate, 1,2,4-Triacetoxynaphthalene, 3,4-bis(acetyloxy)naphthalen-1-yl acetate, 1,4-Triacetoxynaphthalene, 1,2,4-triacetyloxynaphthalene, 1,4-Naphthalenetriol, triacetate, 1,4-Bis(acetyloxy)-2-naphthyl acetate, 1,4-Bis(acetyloxy)-2-naphthyl acetate #