Products 1785055-27-7

CAS 1785055-27-7 is the registry number for 2-Hydroxy-3-(4-phenoxyphenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(4-phenoxyphenyl)propanoic acid (CAS 1785055-27-7) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2-hydroxy-3-(4-phenoxyphenyl)propanoic acid. InChIKey: ZSWWHRBKWSZDNH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O4
Molecular weight258.27 g/mol
IUPAC name2-hydroxy-3-(4-phenoxyphenyl)propanoic acid
InChIKeyZSWWHRBKWSZDNH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)OC2=CC=C(C=C2)CC(C(=O)O)O

Computed by PubChem (NCBI)