Products 1785261-10-0
CAS 1785261-10-0 appears in our catalog under these names: 2–(3–chloro–4–fluorophenyl)–2，2–difluoroethan–1–ol, 2-(3-Chloro-4-fluorophenyl)-2,2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(3-chloro-4-fluorophenyl)-2,2-difluoroethanol (CAS 1785261-10-0) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)-2,2-difluoroethanol. InChIKey: MKAOIRAWXNDKIU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)-2,2-difluoroethanol |
| InChIKey | MKAOIRAWXNDKIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CO)(F)F)Cl)F |
Computed by PubChem (NCBI)