CAS 178557-21-6 appears in our catalog under these names: Desmethyl-8-bromo Dragonfly Hydrochloride, 2C–B–fly (hydrochloride), 2C-B-FLY (hydrochloride), 99.9%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1mg, 10mg, 5mg, 2mg, 1 mg, 5 mg, 10 mg.
2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)ethanamine (CAS 178557-21-6) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)ethanamine. InChIKey: YZDFADGMVOSVIX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 2-(4-bromo-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-8-yl)ethanamine |
| InChIKey | YZDFADGMVOSVIX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C3=C(C(=C21)CCN)OCC3)Br |
Computed by PubChem (NCBI)