CAS 1785605-44-8 is the registry number for 2-(1,1-Dioxo-3,6-dihydro-2H-1λ6-thiopyran-4-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid (CAS 1785605-44-8) is a chemical compound with the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. IUPAC name: 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid. InChIKey: JWJLXWLEUYCKGF-UHFFFAOYSA-N.
| Molecular formula | C9H14O4S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-2-methylpropanoic acid |
| InChIKey | JWJLXWLEUYCKGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CCS(=O)(=O)CC1)C(=O)O |
Computed by PubChem (NCBI)