Products 2138112-79-3
CAS 2138112-79-3 is the registry number for 3-Methyl-8-thiabicyclo(3.2.1)octane-3-carboxylic acid 8,8-dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octane-3-carboxylic acid (CAS 2138112-79-3) is a chemical compound with the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. IUPAC name: 3-methyl-8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: DICQZJKKPGESFJ-UHFFFAOYSA-N.
| Molecular formula | C9H14O4S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 3-methyl-8,8-dioxo-8lambda6-thiabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | DICQZJKKPGESFJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2CCC(C1)S2(=O)=O)C(=O)O |
Computed by PubChem (NCBI)