CAS 1785721-13-2 appears in our catalog under these names: 1-tert-Butyl 2-ethyl 5-hydroxypiperidine-1,2-dicarboxylate, 95%, 1-TERT-BUTYL 2-ETHYL 5-HYDROXYPIPERIDINE-1,2-DICARBOXYLATE, 97%, 97%, 1-tert-Butyl 2-ethyl 5-hydroxypiperidine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 10g.
1-O-tert-butyl 2-O-ethyl 5-hydroxypiperidine-1,2-dicarboxylate (CAS 1785721-13-2) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 5-hydroxypiperidine-1,2-dicarboxylate. InChIKey: QXPPPWXTNBWACT-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 5-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | QXPPPWXTNBWACT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(CN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)