CAS 1214099-00-9 appears in our catalog under these names: 3-tert-Butyl 4-methyl 2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate, 95%, 3-tert-Butyl 4-methyl 2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate, 3-tert-Butyl 4-methyl 2,2,5-trimethyloxazolidine-3,4-dicarboxylate 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-O-tert-butyl 4-O-methyl 2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate (CAS 1214099-00-9) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 3-O-tert-butyl 4-O-methyl 2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate. InChIKey: FRSJJRXFHYGDSO-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 3-O-tert-butyl 4-O-methyl 2,2,5-trimethyl-1,3-oxazolidine-3,4-dicarboxylate |
| InChIKey | FRSJJRXFHYGDSO-UHFFFAOYSA-N |
| SMILES | CC1C(N(C(O1)(C)C)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)