Products 1785761-10-5
CAS 1785761-10-5 appears in our catalog under these names: 4-Chloro-N-(cyclopropylmethyl)aniline hydrochloride, 97%, 4–Chloro–N–(cyclopropylmethyl)aniline hydrochloride, 4-Chloro-N-(cyclopropylmethyl)aniline hydrochloride, 95%+, 95%+, 4-Chloro-N-(cyclopropylmethyl)aniline hydrochloride, 95%+. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
4-chloro-N-(cyclopropylmethyl)aniline;hydrochloride (CAS 1785761-10-5) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 4-chloro-N-(cyclopropylmethyl)aniline;hydrochloride. InChIKey: XOSYWXIVLBCUAP-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 4-chloro-N-(cyclopropylmethyl)aniline;hydrochloride |
| InChIKey | XOSYWXIVLBCUAP-UHFFFAOYSA-N |
| SMILES | C1CC1CNC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)